6a-Hydroxy 17b-Estradiol
Catalog No: FT-0669577
CAS No: 1229-24-9
- Chemical Name: 6a-Hydroxy 17b-Estradiol
- Molecular Formula: C18H24O3
- Molecular Weight: 288.4
- InChI Key: QZZRQURPSRWTLG-WOVZSMEKSA-N
- InChI: InChI=1S/C18H24O3/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(20)9-13(12)15(18)4-5-17(18)21/h2-3,8,12-13,15-17,19-21H,4-7,9H2,1H3/t12-,13-,15+,16+,17+,18+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 1229-24-9 |
| Flash_Point: | 233.2ºC |
| Product_Name: | (6S,8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,6,17-triol |
| Bolling_Point: | 492ºC at 760 mmHg |
| FW: | 288.38100 |
| Melting_Point: | N/A |
| MF: | C18H24O3 |
| Density: | 1.255g/cm3 |
| Refractive_Index: | 1.624 |
|---|---|
| Vapor_Pressure: | 1.69E-10mmHg at 25°C |
| MF: | C18H24O3 |
| Flash_Point: | 233.2ºC |
| LogP: | 3.10010 |
| FW: | 288.38100 |
| Density: | 1.255g/cm3 |
| PSA: | 60.69000 |
| Bolling_Point: | 492ºC at 760 mmHg |
| Exact_Mass: | 288.17300 |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R20/21/22 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302 + H312 + H332-H315-H319-H335-H351 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)